C22H24F2 — CID 139452854
2,3-difluoro-1-methyl-4-[4-(4-prop-1-en-2-ylcyclohexyl)phenyl]benzene (PubChem CID 139452854) has the molecular formula C22H24F2 and a molecular weight of 326.43 g/mol. Its IUPAC name is 2,3-difluoro-1-methyl-4-[4-(4-prop-1-en-2-ylcyclohexyl)phenyl]benzene.
| Compound Name | 2,3-difluoro-1-methyl-4-[4-(4-prop-1-en-2-ylcyclohexyl)phenyl]benzene |
|---|---|
| PubChem CID | 139452854 |
| Molecular Formula | C22H24F2 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 2,3-difluoro-1-methyl-4-[4-(4-prop-1-en-2-ylcyclohexyl)phenyl]benzene |
| SMILES | C=C(C)C1CCC(c2ccc(-c3ccc(C)c(F)c3F)cc2)CC1 |
| InChI | InChI=1S/C22H24F2/c1-14(2)16-5-7-17(8-6-16)18-9-11-19(12-10-18)20-13-4-15(3)21(23)22(20)24/h4,9-13,16-17H,1,5-8H2,2-3H3 |
| InChIKey | PSAUKXZJOLHSAM-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|