About 5-methyl-N-(trifluoromethoxy)-1H-1,2,4-triazole-3-carboxamide
5-methyl-N-(trifluoromethoxy)-1H-1,2,4-triazole-3-carboxamide (PubChem CID 139453541) has the molecular formula C5H5F3N4O2
and a molecular weight of 210.11 g/mol. Its IUPAC name is 5-methyl-N-(trifluoromethoxy)-1H-1,2,4-triazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-methyl-N-(trifluoromethoxy)-1H-1,2,4-triazole-3-carboxamide |
| PubChem CID | 139453541 |
| Molecular Formula | C5H5F3N4O2 |
| Molecular Weight | 210.11 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 5-methyl-N-(trifluoromethoxy)-1H-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1nc(C(=O)NOC(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C5H5F3N4O2/c1-2-9-3(11-10-2)4(13)12-14-5(6,7)8/h1H3,(H,12,13)(H,9,10,11) |
| InChIKey | OFRDUEHFBGESNM-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.11 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-N-(trifluoromethoxy)-1H-1,2,4-triazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-(trifluoromethoxy)-1H-1,2,4-triazole-3-carboxamide?
The IUPAC name of 5-methyl-N-(trifluoromethoxy)-1H-1,2,4-triazole-3-carboxamide (CID 139453541) is 5-methyl-N-(trifluoromethoxy)-1H-1,2,4-triazole-3-carboxamide.
What is the SMILES notation for 5-methyl-N-(trifluoromethoxy)-1H-1,2,4-triazole-3-carboxamide?
The canonical SMILES for 5-methyl-N-(trifluoromethoxy)-1H-1,2,4-triazole-3-carboxamide is Cc1nc(C(=O)NOC(F)(F)F)n[nH]1.
What is the InChIKey of 5-methyl-N-(trifluoromethoxy)-1H-1,2,4-triazole-3-carboxamide?
The InChIKey is OFRDUEHFBGESNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5F3N4O2/c1-2-9-3(11-10-2)4(13)12-14-5(6,7)8/h1H3,(H,12,13)(H,9,10,11).
What are the key properties of 5-methyl-N-(trifluoromethoxy)-1H-1,2,4-triazole-3-carboxamide?
5-methyl-N-(trifluoromethoxy)-1H-1,2,4-triazole-3-carboxamide has a molecular weight of 210.11 g/mol, XLogP of 0.29, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-(trifluoromethoxy)-1H-1,2,4-triazole-3-carboxamide is sourced from PubChem (CID 139453541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).