C21H17BrN2 — CID 139453594
2-(3-bromophenyl)-4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1,6-naphthyridine (PubChem CID 139453594) has the molecular formula C21H17BrN2 and a molecular weight of 377.29 g/mol. Its IUPAC name is 2-(3-bromophenyl)-4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1,6-naphthyridine.
| Compound Name | 2-(3-bromophenyl)-4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1,6-naphthyridine |
|---|---|
| PubChem CID | 139453594 |
| Molecular Formula | C21H17BrN2 |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 2-(3-bromophenyl)-4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1,6-naphthyridine |
| SMILES | C=C(/C=C\C=C/C)c1cc(-c2cccc(Br)c2)nc2ccncc12 |
| InChI | InChI=1S/C21H17BrN2/c1-3-4-5-7-15(2)18-13-21(16-8-6-9-17(22)12-16)24-20-10-11-23-14-19(18)20/h3-14H,2H2,1H3/b4-3-,7-5- |
| InChIKey | BNAUATRZVSYCLU-MRWCJKGFSA-N |
| XLogP | 6.20 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|