C26H43N — CID 139453628
(2Z)-4-[(4Z)-2,8-dimethyl-6-propylnona-2,4-dien-3-yl]-1-ethyl-2-(2-methylbutylidene)pyridine (PubChem CID 139453628) has the molecular formula C26H43N and a molecular weight of 369.64 g/mol. Its IUPAC name is (2Z)-4-[(4Z)-2,8-dimethyl-6-propylnona-2,4-dien-3-yl]-1-ethyl-2-(2-methylbutylidene)pyridine.
| Compound Name | (2Z)-4-[(4Z)-2,8-dimethyl-6-propylnona-2,4-dien-3-yl]-1-ethyl-2-(2-methylbutylidene)pyridine |
|---|---|
| PubChem CID | 139453628 |
| Molecular Formula | C26H43N |
| Molecular Weight | 369.64 g/mol |
| Exact Mass | 369.34 |
| IUPAC Name | (2Z)-4-[(4Z)-2,8-dimethyl-6-propylnona-2,4-dien-3-yl]-1-ethyl-2-(2-methylbutylidene)pyridine |
| SMILES | CCCC(/C=C\C(C1=C/C(=C/C(C)CC)N(CC)C=C1)=C(C)C)CC(C)C |
| InChI | InChI=1S/C26H43N/c1-9-12-23(17-20(4)5)13-14-26(21(6)7)24-15-16-27(11-3)25(19-24)18-22(8)10-2/h13-16,18-20,22-23H,9-12,17H2,1-8H3/b14-13-,25-18- |
| InChIKey | NESIJGWCFHUKSE-NHXSPXMSSA-N |
| XLogP | 8.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.64 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|