C16H25ClFN3 — CID 139453636
N'-[1-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]propyl]carbamimidoyl chloride (PubChem CID 139453636) has the molecular formula C16H25ClFN3 and a molecular weight of 313.85 g/mol. Its IUPAC name is N'-[1-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]propyl]carbamimidoyl chloride.
| Compound Name | N'-[1-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]propyl]carbamimidoyl chloride |
|---|---|
| PubChem CID | 139453636 |
| Molecular Formula | C16H25ClFN3 |
| Molecular Weight | 313.85 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | N'-[1-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]propyl]carbamimidoyl chloride |
| SMILES | CCC(/N=C(/N)Cl)C1=CCCNC1C1C=CC(F)C(C)C1 |
| InChI | InChI=1S/C16H25ClFN3/c1-3-14(21-16(17)19)12-5-4-8-20-15(12)11-6-7-13(18)10(2)9-11/h5-7,10-11,13-15,20H,3-4,8-9H2,1-2H3,(H2,19,21) |
| InChIKey | ZPEQWCVZSIELBH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.85 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|