C16H25FN4 — CID 139453698
(6S)-6-[6-[(5S)-4-fluoro-5-methylcyclohex-2-en-1-yl]-1,2,3,6-tetrahydropyridin-5-yl]-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 139453698) has the molecular formula C16H25FN4 and a molecular weight of 292.40 g/mol. Its IUPAC name is (6S)-6-[6-[(5S)-4-fluoro-5-methylcyclohex-2-en-1-yl]-1,2,3,6-tetrahydropyridin-5-yl]-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | (6S)-6-[6-[(5S)-4-fluoro-5-methylcyclohex-2-en-1-yl]-1,2,3,6-tetrahydropyridin-5-yl]-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 139453698 |
| Molecular Formula | C16H25FN4 |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.21 |
| IUPAC Name | (6S)-6-[6-[(5S)-4-fluoro-5-methylcyclohex-2-en-1-yl]-1,2,3,6-tetrahydropyridin-5-yl]-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | C[C@H]1CC(C2NCCC=C2[C@@H]2CCN=C(N)N2)C=CC1F |
| InChI | InChI=1S/C16H25FN4/c1-10-9-11(4-5-13(10)17)15-12(3-2-7-19-15)14-6-8-20-16(18)21-14/h3-5,10-11,13-15,19H,2,6-9H2,1H3,(H3,18,20,21)/t10-,11?,13?,14-,15?/m0/s1 |
| InChIKey | VIVUKGPAKZPGHX-KMTWBRQNSA-N |
| XLogP | 1.50 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|