About (Z)-2-(cyclohexa-2,4-dien-1-ylideneamino)-N-[(3-cyclohexylpiperazin-1-yl)methyl]ethenamine
(Z)-2-(cyclohexa-2,4-dien-1-ylideneamino)-N-[(3-cyclohexylpiperazin-1-yl)methyl]ethenamine (PubChem CID 139454009) has the molecular formula C19H30N4
and a molecular weight of 314.48 g/mol. Its IUPAC name is (Z)-2-(cyclohexa-2,4-dien-1-ylideneamino)-N-[(3-cyclohexylpiperazin-1-yl)methyl]ethenamine.
Molecular Properties
| Compound Name | (Z)-2-(cyclohexa-2,4-dien-1-ylideneamino)-N-[(3-cyclohexylpiperazin-1-yl)methyl]ethenamine |
| PubChem CID | 139454009 |
| Molecular Formula | C19H30N4 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | (Z)-2-(cyclohexa-2,4-dien-1-ylideneamino)-N-[(3-cyclohexylpiperazin-1-yl)methyl]ethenamine |
| SMILES | C1=CC/C(=N\C=C/NCN2CCNC(C3CCCCC3)C2)C=C1 |
| InChI | InChI=1S/C19H30N4/c1-3-7-17(8-4-1)19-15-23(14-13-22-19)16-20-11-12-21-18-9-5-2-6-10-18/h2,5-6,9,11-12,17,19-20,22H,1,3-4,7-8,10,13-16H2/b12-11-,21-18- |
| InChIKey | BBGFGGMILMPXMZ-AKFHJJIWSA-N |
| XLogP | 2.82 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(cyclohexa-2,4-dien-1-ylideneamino)-N-[(3-cyclohexylpiperazin-1-yl)methyl]ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(cyclohexa-2,4-dien-1-ylideneamino)-N-[(3-cyclohexylpiperazin-1-yl)methyl]ethenamine?
The IUPAC name of (Z)-2-(cyclohexa-2,4-dien-1-ylideneamino)-N-[(3-cyclohexylpiperazin-1-yl)methyl]ethenamine (CID 139454009) is (Z)-2-(cyclohexa-2,4-dien-1-ylideneamino)-N-[(3-cyclohexylpiperazin-1-yl)methyl]ethenamine.
What is the SMILES notation for (Z)-2-(cyclohexa-2,4-dien-1-ylideneamino)-N-[(3-cyclohexylpiperazin-1-yl)methyl]ethenamine?
The canonical SMILES for (Z)-2-(cyclohexa-2,4-dien-1-ylideneamino)-N-[(3-cyclohexylpiperazin-1-yl)methyl]ethenamine is C1=CC/C(=N\C=C/NCN2CCNC(C3CCCCC3)C2)C=C1.
What is the InChIKey of (Z)-2-(cyclohexa-2,4-dien-1-ylideneamino)-N-[(3-cyclohexylpiperazin-1-yl)methyl]ethenamine?
The InChIKey is BBGFGGMILMPXMZ-AKFHJJIWSA-N. The full InChI is InChI=1S/C19H30N4/c1-3-7-17(8-4-1)19-15-23(14-13-22-19)16-20-11-12-21-18-9-5-2-6-10-18/h2,5-6,9,11-12,17,19-20,22H,1,3-4,7-8,10,13-16H2/b12-11-,21-18-.
What are the key properties of (Z)-2-(cyclohexa-2,4-dien-1-ylideneamino)-N-[(3-cyclohexylpiperazin-1-yl)methyl]ethenamine?
(Z)-2-(cyclohexa-2,4-dien-1-ylideneamino)-N-[(3-cyclohexylpiperazin-1-yl)methyl]ethenamine has a molecular weight of 314.48 g/mol, XLogP of 2.82, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(cyclohexa-2,4-dien-1-ylideneamino)-N-[(3-cyclohexylpiperazin-1-yl)methyl]ethenamine is sourced from PubChem (CID 139454009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).