C19H23NO2 — CID 139454386
N,1-bis(4-methoxy-3-methylphenyl)propan-2-imine (PubChem CID 139454386) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N,1-bis(4-methoxy-3-methylphenyl)propan-2-imine.
| Compound Name | N,1-bis(4-methoxy-3-methylphenyl)propan-2-imine |
|---|---|
| PubChem CID | 139454386 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N,1-bis(4-methoxy-3-methylphenyl)propan-2-imine |
| SMILES | COc1ccc(C/C(C)=N/c2ccc(OC)c(C)c2)cc1C |
| InChI | InChI=1S/C19H23NO2/c1-13-10-16(6-8-18(13)21-4)12-15(3)20-17-7-9-19(22-5)14(2)11-17/h6-11H,12H2,1-5H3/b20-15+ |
| InChIKey | XHFLPDBDYXTBIP-HMMYKYKNSA-N |
| XLogP | 4.66 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|