C38H22N4S2 — CID 139455067
2-[3-(1,3-benzothiazol-2-yl)-5-[4-(1,10-phenanthrolin-2-yl)phenyl]phenyl]-1,3-benzothiazole (PubChem CID 139455067) has the molecular formula C38H22N4S2 and a molecular weight of 598.76 g/mol. Its IUPAC name is 2-[3-(1,3-benzothiazol-2-yl)-5-[4-(1,10-phenanthrolin-2-yl)phenyl]phenyl]-1,3-benzothiazole.
| Compound Name | 2-[3-(1,3-benzothiazol-2-yl)-5-[4-(1,10-phenanthrolin-2-yl)phenyl]phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 139455067 |
| Molecular Formula | C38H22N4S2 |
| Molecular Weight | 598.76 g/mol |
| Exact Mass | 598.13 |
| IUPAC Name | 2-[3-(1,3-benzothiazol-2-yl)-5-[4-(1,10-phenanthrolin-2-yl)phenyl]phenyl]-1,3-benzothiazole |
| SMILES | c1cnc2c(c1)ccc1ccc(-c3ccc(-c4cc(-c5nc6ccccc6s5)cc(-c5nc6ccccc6s5)c4)cc3)nc12 |
| InChI | InChI=1S/C38H22N4S2/c1-3-9-33-31(7-1)41-37(43-33)28-20-27(21-29(22-28)38-42-32-8-2-4-10-34(32)44-38)23-11-13-24(14-12-23)30-18-17-26-16-15-25-6-5-19-39-35(25)36(26)40-30/h1-22H |
| InChIKey | NCKGMLOOQLGDIW-UHFFFAOYSA-N |
| XLogP | 10.67 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.76 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|