C20H23FN6S — CID 139455205
2-amino-5-[2-(5-fluoro-2-propylphenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carbothioamide (PubChem CID 139455205) has the molecular formula C20H23FN6S and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-amino-5-[2-(5-fluoro-2-propylphenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carbothioamide.
| Compound Name | 2-amino-5-[2-(5-fluoro-2-propylphenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carbothioamide |
|---|---|
| PubChem CID | 139455205 |
| Molecular Formula | C20H23FN6S |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 2-amino-5-[2-(5-fluoro-2-propylphenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carbothioamide |
| SMILES | CCCc1ccc(F)cc1C1CCCN1c1ccn2nc(N)c(C(N)=S)c2n1 |
| InChI | InChI=1S/C20H23FN6S/c1-2-4-12-6-7-13(21)11-14(12)15-5-3-9-26(15)16-8-10-27-20(24-16)17(19(23)28)18(22)25-27/h6-8,10-11,15H,2-5,9H2,1H3,(H2,22,25)(H2,23,28) |
| InChIKey | VBOMLDIGVNAHCJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|