C32H40FN7O2 — CID 139455556
2-[(2S)-4-[7-(2,3-dimethylphenyl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-1-(2-fluoroprop-2-enoyl)piperazin-2-yl]acetonitrile (PubChem CID 139455556) has the molecular formula C32H40FN7O2 and a molecular weight of 573.72 g/mol. Its IUPAC name is 2-[(2S)-4-[7-(2,3-dimethylphenyl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-1-(2-fluoroprop-2-enoyl)piperazin-2-yl]acetonitrile.
| Compound Name | 2-[(2S)-4-[7-(2,3-dimethylphenyl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-1-(2-fluoroprop-2-enoyl)piperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 139455556 |
| Molecular Formula | C32H40FN7O2 |
| Molecular Weight | 573.72 g/mol |
| Exact Mass | 573.32 |
| IUPAC Name | 2-[(2S)-4-[7-(2,3-dimethylphenyl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-1-(2-fluoroprop-2-enoyl)piperazin-2-yl]acetonitrile |
| SMILES | C=C(F)C(=O)N1CCN(c2nc(OCC34CCCN3CCC4)nc3c2CCN(c2cccc(C)c2C)C3)C[C@@H]1CC#N |
| InChI | InChI=1S/C32H40FN7O2/c1-22-7-4-8-28(23(22)2)37-16-10-26-27(20-37)35-31(42-21-32-11-5-14-39(32)15-6-12-32)36-29(26)38-17-18-40(30(41)24(3)33)25(19-38)9-13-34/h4,7-8,25H,3,5-6,9-12,14-21H2,1-2H3/t25-/m0/s1 |
| InChIKey | TZROEKZOKWAMBN-VWLOTQADSA-N |
| XLogP | 4.08 |
| TPSA | 88.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.72 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|