C57H43N7 — CID 139455665
2-[(3E,5Z)-7-[3-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)phenyl]hepta-1,3,5-trien-4-yl]-N-methyl-N-[4-(9-phenylcarbazol-3-yl)phenyl]aniline (PubChem CID 139455665) has the molecular formula C57H43N7 and a molecular weight of 826.02 g/mol. Its IUPAC name is 2-[(3E,5Z)-7-[3-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)phenyl]hepta-1,3,5-trien-4-yl]-N-methyl-N-[4-(9-phenylcarbazol-3-yl)phenyl]aniline.
| Compound Name | 2-[(3E,5Z)-7-[3-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)phenyl]hepta-1,3,5-trien-4-yl]-N-methyl-N-[4-(9-phenylcarbazol-3-yl)phenyl]aniline |
|---|---|
| PubChem CID | 139455665 |
| Molecular Formula | C57H43N7 |
| Molecular Weight | 826.02 g/mol |
| Exact Mass | 825.36 |
| IUPAC Name | 2-[(3E,5Z)-7-[3-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)phenyl]hepta-1,3,5-trien-4-yl]-N-methyl-N-[4-(9-phenylcarbazol-3-yl)phenyl]aniline |
| SMILES | C=C/C=C(\C=C/Cc1cccc(-c2nc(-c3ccccn3)nc(-c3ccccn3)n2)c1)c1ccccc1N(C)c1ccc(-c2ccc3c(c2)c2ccccc2n3-c2ccccc2)cc1 |
| InChI | InChI=1S/C57H43N7/c1-3-17-42(20-15-18-40-19-16-21-44(38-40)55-60-56(50-26-11-13-36-58-50)62-57(61-55)51-27-12-14-37-59-51)47-24-7-9-28-52(47)63(2)45-33-30-41(31-34-45)43-32-35-54-49(39-43)48-25-8-10-29-53(48)64(54)46-22-5-4-6-23-46/h3-17,19-39H,1,18H2,2H3/b20-15-,42-17+ |
| InChIKey | XZMYTHNFPRPVCN-BIQYRCMESA-N |
| XLogP | 13.56 |
| TPSA | 72.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.02 |
| LogP ≤ 5 | 13.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|