C63H45N5 — CID 139455669
2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-[4-[9-(2-phenylphenyl)-1,2-dihydrocarbazol-3-yl]cyclohexa-1,3-dien-1-yl]carbazole (PubChem CID 139455669) has the molecular formula C63H45N5 and a molecular weight of 872.09 g/mol. Its IUPAC name is 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-[4-[9-(2-phenylphenyl)-1,2-dihydrocarbazol-3-yl]cyclohexa-1,3-dien-1-yl]carbazole.
| Compound Name | 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-[4-[9-(2-phenylphenyl)-1,2-dihydrocarbazol-3-yl]cyclohexa-1,3-dien-1-yl]carbazole |
|---|---|
| PubChem CID | 139455669 |
| Molecular Formula | C63H45N5 |
| Molecular Weight | 872.09 g/mol |
| Exact Mass | 871.37 |
| IUPAC Name | 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-[4-[9-(2-phenylphenyl)-1,2-dihydrocarbazol-3-yl]cyclohexa-1,3-dien-1-yl]carbazole |
| SMILES | C1=C(C2=Cc3c(n(-c4ccccc4-c4ccccc4)c4ccccc34)CC2)CCC(n2c3ccccc3c3ccc(-c4cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4)cc32)=C1 |
| InChI | InChI=1S/C63H45N5/c1-4-17-43(18-5-1)51-25-10-13-28-56(51)68-58-30-15-12-27-53(58)55-40-47(34-38-59(55)68)42-31-35-50(36-32-42)67-57-29-14-11-26-52(57)54-37-33-48(41-60(54)67)46-23-16-24-49(39-46)63-65-61(44-19-6-2-7-20-44)64-62(66-63)45-21-8-3-9-22-45/h1-31,33,35,37,39-41H,32,34,36,38H2 |
| InChIKey | PWPBHJUWSDYUKN-UHFFFAOYSA-N |
| XLogP | 15.85 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.09 |
| LogP ≤ 5 | 15.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |