C10H18FNO — CID 139455860
(3E)-5-amino-3-fluoro-2,2,6-trimethylhepta-3,6-dien-1-ol (PubChem CID 139455860) has the molecular formula C10H18FNO and a molecular weight of 187.26 g/mol. Its IUPAC name is (3E)-5-amino-3-fluoro-2,2,6-trimethylhepta-3,6-dien-1-ol.
| Compound Name | (3E)-5-amino-3-fluoro-2,2,6-trimethylhepta-3,6-dien-1-ol |
|---|---|
| PubChem CID | 139455860 |
| Molecular Formula | C10H18FNO |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (3E)-5-amino-3-fluoro-2,2,6-trimethylhepta-3,6-dien-1-ol |
| SMILES | C=C(C)C(N)/C=C(/F)C(C)(C)CO |
| InChI | InChI=1S/C10H18FNO/c1-7(2)8(12)5-9(11)10(3,4)6-13/h5,8,13H,1,6,12H2,2-4H3/b9-5+ |
| InChIKey | BNAJNJAGUNRUDO-WEVVVXLNSA-N |
| XLogP | 1.76 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|