C11H15N — CID 139456051
(6E)-3,4-dimethyl-6-propylidenecyclohexa-2,4-dien-1-imine (PubChem CID 139456051) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is (6E)-3,4-dimethyl-6-propylidenecyclohexa-2,4-dien-1-imine.
| Compound Name | (6E)-3,4-dimethyl-6-propylidenecyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 139456051 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (6E)-3,4-dimethyl-6-propylidenecyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=C(C)C(C)=C\C1=C/CC |
| InChI | InChI=1S/C11H15N/c1-4-5-10-6-8(2)9(3)7-11(10)12/h5-7,12H,4H2,1-3H3/b10-5+,12-11+ |
| InChIKey | BLLKFHVUVFSDFY-WKWSCTOISA-N |
| XLogP | 3.25 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|