C22H33N7O10 — CID 139456054
(3R)-4-[[2-[[2-[[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]amino]-3-[[6-(2,5-dioxopyrrol-1-yl)-1-hydroxyhexyl]amino]-4-oxobutanoic acid (PubChem CID 139456054) has the molecular formula C22H33N7O10 and a molecular weight of 555.55 g/mol. Its IUPAC name is (3R)-4-[[2-[[2-[[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]amino]-3-[[6-(2,5-dioxopyrrol-1-yl)-1-hydroxyhexyl]amino]-4-oxobutanoic acid.
| Compound Name | (3R)-4-[[2-[[2-[[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]amino]-3-[[6-(2,5-dioxopyrrol-1-yl)-1-hydroxyhexyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139456054 |
| Molecular Formula | C22H33N7O10 |
| Molecular Weight | 555.55 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | (3R)-4-[[2-[[2-[[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]amino]-3-[[6-(2,5-dioxopyrrol-1-yl)-1-hydroxyhexyl]amino]-4-oxobutanoic acid |
| SMILES | NC(=O)CNC(=O)CNC(=O)CNC(=O)CNC(=O)[C@@H](CC(=O)O)NC(O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C22H33N7O10/c23-14(30)9-24-16(32)10-25-17(33)11-26-18(34)12-27-22(39)13(8-21(37)38)28-15(31)4-2-1-3-7-29-19(35)5-6-20(29)36/h5-6,13,15,28,31H,1-4,7-12H2,(H2,23,30)(H,24,32)(H,25,33)(H,26,34)(H,27,39)(H,37,38)/t13-,15?/m1/s1 |
| InChIKey | KHPYOMNSBYODBP-AFYYWNPRSA-N |
| XLogP | -4.83 |
| TPSA | 266.43 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.55 |
| LogP ≤ 5 | -4.83 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|