C11H18FN — CID 139456278
(4aS)-3-fluoro-4-methyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-amine (PubChem CID 139456278) has the molecular formula C11H18FN and a molecular weight of 183.27 g/mol. Its IUPAC name is (4aS)-3-fluoro-4-methyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-amine.
| Compound Name | (4aS)-3-fluoro-4-methyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 139456278 |
| Molecular Formula | C11H18FN |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (4aS)-3-fluoro-4-methyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-amine |
| SMILES | CC1C(F)=CC(N)C2CCCC[C@H]12 |
| InChI | InChI=1S/C11H18FN/c1-7-8-4-2-3-5-9(8)11(13)6-10(7)12/h6-9,11H,2-5,13H2,1H3/t7?,8-,9?,11?/m1/s1 |
| InChIKey | YPODOIQGYQJPTP-PPMKJDBRSA-N |
| XLogP | 2.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |