About (4Z)-2-(dimethylamino)-4-ethenylhepta-4,6-dienal
(4Z)-2-(dimethylamino)-4-ethenylhepta-4,6-dienal (PubChem CID 139456286) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is (4Z)-2-(dimethylamino)-4-ethenylhepta-4,6-dienal.
Molecular Properties
| Compound Name | (4Z)-2-(dimethylamino)-4-ethenylhepta-4,6-dienal |
| PubChem CID | 139456286 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (4Z)-2-(dimethylamino)-4-ethenylhepta-4,6-dienal |
| SMILES | C=C/C=C(\C=C)CC(C=O)N(C)C |
| InChI | InChI=1S/C11H17NO/c1-5-7-10(6-2)8-11(9-13)12(3)4/h5-7,9,11H,1-2,8H2,3-4H3/b10-7+ |
| InChIKey | LINOJMIHAXFMQR-JXMROGBWSA-N |
| XLogP | 1.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-2-(dimethylamino)-4-ethenylhepta-4,6-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-2-(dimethylamino)-4-ethenylhepta-4,6-dienal?
The IUPAC name of (4Z)-2-(dimethylamino)-4-ethenylhepta-4,6-dienal (CID 139456286) is (4Z)-2-(dimethylamino)-4-ethenylhepta-4,6-dienal.
What is the SMILES notation for (4Z)-2-(dimethylamino)-4-ethenylhepta-4,6-dienal?
The canonical SMILES for (4Z)-2-(dimethylamino)-4-ethenylhepta-4,6-dienal is C=C/C=C(\C=C)CC(C=O)N(C)C.
What is the InChIKey of (4Z)-2-(dimethylamino)-4-ethenylhepta-4,6-dienal?
The InChIKey is LINOJMIHAXFMQR-JXMROGBWSA-N. The full InChI is InChI=1S/C11H17NO/c1-5-7-10(6-2)8-11(9-13)12(3)4/h5-7,9,11H,1-2,8H2,3-4H3/b10-7+.
What are the key properties of (4Z)-2-(dimethylamino)-4-ethenylhepta-4,6-dienal?
(4Z)-2-(dimethylamino)-4-ethenylhepta-4,6-dienal has a molecular weight of 179.26 g/mol, XLogP of 1.80, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-2-(dimethylamino)-4-ethenylhepta-4,6-dienal is sourced from PubChem (CID 139456286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).