C18H32N4 — CID 139456561
N'-[(3-cyclohexyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)methyl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 139456561) has the molecular formula C18H32N4 and a molecular weight of 304.48 g/mol. Its IUPAC name is N'-[(3-cyclohexyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)methyl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-[(3-cyclohexyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)methyl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 139456561 |
| Molecular Formula | C18H32N4 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | N'-[(3-cyclohexyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)methyl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | CNCCN(C)Cc1nn2c(c1C1CCCCC1)CCCC2 |
| InChI | InChI=1S/C18H32N4/c1-19-11-13-21(2)14-16-18(15-8-4-3-5-9-15)17-10-6-7-12-22(17)20-16/h15,19H,3-14H2,1-2H3 |
| InChIKey | HXDBLFMCLFYCLC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |