C23H40F2N4O2 — CID 139456625
N'-[[3-[4,4-bis(ethoxymethyl)cyclohexyl]-5,5-difluoro-4,6-dihydropyrrolo[1,2-b]pyrazol-2-yl]methyl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 139456625) has the molecular formula C23H40F2N4O2 and a molecular weight of 442.60 g/mol. Its IUPAC name is N'-[[3-[4,4-bis(ethoxymethyl)cyclohexyl]-5,5-difluoro-4,6-dihydropyrrolo[1,2-b]pyrazol-2-yl]methyl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-[[3-[4,4-bis(ethoxymethyl)cyclohexyl]-5,5-difluoro-4,6-dihydropyrrolo[1,2-b]pyrazol-2-yl]methyl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 139456625 |
| Molecular Formula | C23H40F2N4O2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | N'-[[3-[4,4-bis(ethoxymethyl)cyclohexyl]-5,5-difluoro-4,6-dihydropyrrolo[1,2-b]pyrazol-2-yl]methyl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | CCOCC1(COCC)CCC(c2c(CN(C)CCNC)nn3c2CC(F)(F)C3)CC1 |
| InChI | InChI=1S/C23H40F2N4O2/c1-5-30-16-22(17-31-6-2)9-7-18(8-10-22)21-19(14-28(4)12-11-26-3)27-29-15-23(24,25)13-20(21)29/h18,26H,5-17H2,1-4H3 |
| InChIKey | PWLNMOLGRQGTQD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |