C20H19N7O4S — CID 139456782
N-[[3-hydroxy-5-[[3-[(1-methylimidazol-4-yl)sulfonylamino]quinoxalin-2-yl]amino]phenyl]methyl]formamide (PubChem CID 139456782) has the molecular formula C20H19N7O4S and a molecular weight of 453.48 g/mol. Its IUPAC name is N-[[3-hydroxy-5-[[3-[(1-methylimidazol-4-yl)sulfonylamino]quinoxalin-2-yl]amino]phenyl]methyl]formamide.
| Compound Name | N-[[3-hydroxy-5-[[3-[(1-methylimidazol-4-yl)sulfonylamino]quinoxalin-2-yl]amino]phenyl]methyl]formamide |
|---|---|
| PubChem CID | 139456782 |
| Molecular Formula | C20H19N7O4S |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | N-[[3-hydroxy-5-[[3-[(1-methylimidazol-4-yl)sulfonylamino]quinoxalin-2-yl]amino]phenyl]methyl]formamide |
| SMILES | Cn1cnc(S(=O)(=O)Nc2nc3ccccc3nc2Nc2cc(O)cc(CNC=O)c2)c1 |
| InChI | InChI=1S/C20H19N7O4S/c1-27-10-18(22-11-27)32(30,31)26-20-19(24-16-4-2-3-5-17(16)25-20)23-14-6-13(9-21-12-28)7-15(29)8-14/h2-8,10-12,29H,9H2,1H3,(H,21,28)(H,23,24)(H,25,26) |
| InChIKey | VLVZUSVBNLBAHU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 151.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|