About 3-fluoro-5-methoxy-2-[4-(4-pentylcyclohexyl)cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-diene
3-fluoro-5-methoxy-2-[4-(4-pentylcyclohexyl)cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-diene (PubChem CID 139457529) has the molecular formula C24H35FO
and a molecular weight of 358.54 g/mol. Its IUPAC name is 3-fluoro-5-methoxy-2-[4-(4-pentylcyclohexyl)cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 3-fluoro-5-methoxy-2-[4-(4-pentylcyclohexyl)cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-diene |
| PubChem CID | 139457529 |
| Molecular Formula | C24H35FO |
| Molecular Weight | 358.54 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | 3-fluoro-5-methoxy-2-[4-(4-pentylcyclohexyl)cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-diene |
| SMILES | CCCCCC1CCC(C2=CCC(C3=CCC(OC)C=C3F)C=C2)CC1 |
| InChI | InChI=1S/C24H35FO/c1-3-4-5-6-18-7-9-19(10-8-18)20-11-13-21(14-12-20)23-16-15-22(26-2)17-24(23)25/h11-13,16-19,21-22H,3-10,14-15H2,1-2H3 |
| InChIKey | SDDXCLYRTSBXPL-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.54 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-5-methoxy-2-[4-(4-pentylcyclohexyl)cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-5-methoxy-2-[4-(4-pentylcyclohexyl)cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-diene?
The IUPAC name of 3-fluoro-5-methoxy-2-[4-(4-pentylcyclohexyl)cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-diene (CID 139457529) is 3-fluoro-5-methoxy-2-[4-(4-pentylcyclohexyl)cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-diene.
What is the SMILES notation for 3-fluoro-5-methoxy-2-[4-(4-pentylcyclohexyl)cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-diene?
The canonical SMILES for 3-fluoro-5-methoxy-2-[4-(4-pentylcyclohexyl)cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-diene is CCCCCC1CCC(C2=CCC(C3=CCC(OC)C=C3F)C=C2)CC1.
What is the InChIKey of 3-fluoro-5-methoxy-2-[4-(4-pentylcyclohexyl)cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-diene?
The InChIKey is SDDXCLYRTSBXPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H35FO/c1-3-4-5-6-18-7-9-19(10-8-18)20-11-13-21(14-12-20)23-16-15-22(26-2)17-24(23)25/h11-13,16-19,21-22H,3-10,14-15H2,1-2H3.
What are the key properties of 3-fluoro-5-methoxy-2-[4-(4-pentylcyclohexyl)cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-diene?
3-fluoro-5-methoxy-2-[4-(4-pentylcyclohexyl)cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-diene has a molecular weight of 358.54 g/mol, XLogP of 7.07, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-5-methoxy-2-[4-(4-pentylcyclohexyl)cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-diene is sourced from PubChem (CID 139457529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).