C10H14F2O — CID 139457574
(3E,5Z)-4-(difluoromethoxy)-5-ethylhepta-1,3,5-triene (PubChem CID 139457574) has the molecular formula C10H14F2O and a molecular weight of 188.22 g/mol. Its IUPAC name is (3E,5Z)-4-(difluoromethoxy)-5-ethylhepta-1,3,5-triene.
| Compound Name | (3E,5Z)-4-(difluoromethoxy)-5-ethylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 139457574 |
| Molecular Formula | C10H14F2O |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | (3E,5Z)-4-(difluoromethoxy)-5-ethylhepta-1,3,5-triene |
| SMILES | C=C/C=C(OC(F)F)\C(=C/C)CC |
| InChI | InChI=1S/C10H14F2O/c1-4-7-9(13-10(11)12)8(5-2)6-3/h4-5,7,10H,1,6H2,2-3H3/b8-5-,9-7+ |
| InChIKey | SPOSYUZENCSIQY-ANVCMGODSA-N |
| XLogP | 3.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|