About [(5S)-2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl]methanol
[(5S)-2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl]methanol (PubChem CID 139457728) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is [(5S)-2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl]methanol.
Molecular Properties
| Compound Name | [(5S)-2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl]methanol |
| PubChem CID | 139457728 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | [(5S)-2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl]methanol |
| SMILES | CC(C)C1=NC[C@@H](CO)N1 |
| InChI | InChI=1S/C7H14N2O/c1-5(2)7-8-3-6(4-10)9-7/h5-6,10H,3-4H2,1-2H3,(H,8,9)/t6-/m0/s1 |
| InChIKey | OFTRAEJWCWSUHE-LURJTMIESA-N |
| XLogP | 0.00 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(5S)-2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5S)-2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl]methanol?
The IUPAC name of [(5S)-2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl]methanol (CID 139457728) is [(5S)-2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl]methanol.
What is the SMILES notation for [(5S)-2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl]methanol?
The canonical SMILES for [(5S)-2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl]methanol is CC(C)C1=NC[C@@H](CO)N1.
What is the InChIKey of [(5S)-2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl]methanol?
The InChIKey is OFTRAEJWCWSUHE-LURJTMIESA-N. The full InChI is InChI=1S/C7H14N2O/c1-5(2)7-8-3-6(4-10)9-7/h5-6,10H,3-4H2,1-2H3,(H,8,9)/t6-/m0/s1.
What are the key properties of [(5S)-2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl]methanol?
[(5S)-2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl]methanol has a molecular weight of 142.20 g/mol, XLogP of 0.00, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(5S)-2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl]methanol is sourced from PubChem (CID 139457728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).