C16H21N — CID 139457875
9-ethyl-5,6-dimethyl-1,5,6,9a-tetrahydrocarbazole (PubChem CID 139457875) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 9-ethyl-5,6-dimethyl-1,5,6,9a-tetrahydrocarbazole.
| Compound Name | 9-ethyl-5,6-dimethyl-1,5,6,9a-tetrahydrocarbazole |
|---|---|
| PubChem CID | 139457875 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 9-ethyl-5,6-dimethyl-1,5,6,9a-tetrahydrocarbazole |
| SMILES | CCN1C2=C(C3=CC=CCC31)C(C)C(C)C=C2 |
| InChI | InChI=1S/C16H21N/c1-4-17-14-8-6-5-7-13(14)16-12(3)11(2)9-10-15(16)17/h5-7,9-12,14H,4,8H2,1-3H3 |
| InChIKey | XXOFZQBLHNLXRD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |