C9H14N2 — CID 139458636
7-methyl-3,4,5,6,7,8-hexahydrocinnoline (PubChem CID 139458636) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 7-methyl-3,4,5,6,7,8-hexahydrocinnoline.
| Compound Name | 7-methyl-3,4,5,6,7,8-hexahydrocinnoline |
|---|---|
| PubChem CID | 139458636 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 7-methyl-3,4,5,6,7,8-hexahydrocinnoline |
| SMILES | CC1CCC2=C(C1)N=NCC2 |
| InChI | InChI=1S/C9H14N2/c1-7-2-3-8-4-5-10-11-9(8)6-7/h7H,2-6H2,1H3 |
| InChIKey | ZIDKIJNMJPUDOU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |