C18H21ClFN4O3PS — CID 139458762
(6-amino-2-pyridinyl)sulfonylphosphanyl-[6-chloro-5-fluoro-2-(2,2,4-trimethylpyrrolidin-1-yl)-3-pyridinyl]methanone (PubChem CID 139458762) has the molecular formula C18H21ClFN4O3PS and a molecular weight of 458.88 g/mol. Its IUPAC name is (6-amino-2-pyridinyl)sulfonylphosphanyl-[6-chloro-5-fluoro-2-(2,2,4-trimethylpyrrolidin-1-yl)-3-pyridinyl]methanone.
| Compound Name | (6-amino-2-pyridinyl)sulfonylphosphanyl-[6-chloro-5-fluoro-2-(2,2,4-trimethylpyrrolidin-1-yl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 139458762 |
| Molecular Formula | C18H21ClFN4O3PS |
| Molecular Weight | 458.88 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | (6-amino-2-pyridinyl)sulfonylphosphanyl-[6-chloro-5-fluoro-2-(2,2,4-trimethylpyrrolidin-1-yl)-3-pyridinyl]methanone |
| SMILES | CC1CN(c2nc(Cl)c(F)cc2C(=O)PS(=O)(=O)c2cccc(N)n2)C(C)(C)C1 |
| InChI | InChI=1S/C18H21ClFN4O3PS/c1-10-8-18(2,3)24(9-10)16-11(7-12(20)15(19)23-16)17(25)28-29(26,27)14-6-4-5-13(21)22-14/h4-7,10,28H,8-9H2,1-3H3,(H2,21,22) |
| InChIKey | DWYDWICMOJKXRN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.88 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|