About (6E)-6-[(2Z)-penta-2,4-dienylidene]-5-propan-2-ylidene-1,3-oxazinane
(6E)-6-[(2Z)-penta-2,4-dienylidene]-5-propan-2-ylidene-1,3-oxazinane (PubChem CID 139458884) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is (6E)-6-[(2Z)-penta-2,4-dienylidene]-5-propan-2-ylidene-1,3-oxazinane.
Molecular Properties
| Compound Name | (6E)-6-[(2Z)-penta-2,4-dienylidene]-5-propan-2-ylidene-1,3-oxazinane |
| PubChem CID | 139458884 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (6E)-6-[(2Z)-penta-2,4-dienylidene]-5-propan-2-ylidene-1,3-oxazinane |
| SMILES | C=C/C=C\C=C1\OCNCC1=C(C)C |
| InChI | InChI=1S/C12H17NO/c1-4-5-6-7-12-11(10(2)3)8-13-9-14-12/h4-7,13H,1,8-9H2,2-3H3/b6-5-,12-7+ |
| InChIKey | VIUZTHROCKAYTB-UNKATYBDSA-N |
| XLogP | 2.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (6E)-6-[(2Z)-penta-2,4-dienylidene]-5-propan-2-ylidene-1,3-oxazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-6-[(2Z)-penta-2,4-dienylidene]-5-propan-2-ylidene-1,3-oxazinane?
The IUPAC name of (6E)-6-[(2Z)-penta-2,4-dienylidene]-5-propan-2-ylidene-1,3-oxazinane (CID 139458884) is (6E)-6-[(2Z)-penta-2,4-dienylidene]-5-propan-2-ylidene-1,3-oxazinane.
What is the SMILES notation for (6E)-6-[(2Z)-penta-2,4-dienylidene]-5-propan-2-ylidene-1,3-oxazinane?
The canonical SMILES for (6E)-6-[(2Z)-penta-2,4-dienylidene]-5-propan-2-ylidene-1,3-oxazinane is C=C/C=C\C=C1\OCNCC1=C(C)C.
What is the InChIKey of (6E)-6-[(2Z)-penta-2,4-dienylidene]-5-propan-2-ylidene-1,3-oxazinane?
The InChIKey is VIUZTHROCKAYTB-UNKATYBDSA-N. The full InChI is InChI=1S/C12H17NO/c1-4-5-6-7-12-11(10(2)3)8-13-9-14-12/h4-7,13H,1,8-9H2,2-3H3/b6-5-,12-7+.
What are the key properties of (6E)-6-[(2Z)-penta-2,4-dienylidene]-5-propan-2-ylidene-1,3-oxazinane?
(6E)-6-[(2Z)-penta-2,4-dienylidene]-5-propan-2-ylidene-1,3-oxazinane has a molecular weight of 191.27 g/mol, XLogP of 2.53, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-6-[(2Z)-penta-2,4-dienylidene]-5-propan-2-ylidene-1,3-oxazinane is sourced from PubChem (CID 139458884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).