C14H24N2O — CID 139459466
(3R)-1-[(2S,4Z,6Z)-2-(methylamino)-3-methylideneocta-4,6-dienyl]pyrrolidin-3-ol (PubChem CID 139459466) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is (3R)-1-[(2S,4Z,6Z)-2-(methylamino)-3-methylideneocta-4,6-dienyl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[(2S,4Z,6Z)-2-(methylamino)-3-methylideneocta-4,6-dienyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 139459466 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | (3R)-1-[(2S,4Z,6Z)-2-(methylamino)-3-methylideneocta-4,6-dienyl]pyrrolidin-3-ol |
| SMILES | C=C(/C=C\C=C/C)[C@@H](CN1CC[C@@H](O)C1)NC |
| InChI | InChI=1S/C14H24N2O/c1-4-5-6-7-12(2)14(15-3)11-16-9-8-13(17)10-16/h4-7,13-15,17H,2,8-11H2,1,3H3/b5-4-,7-6-/t13-,14-/m1/s1 |
| InChIKey | REQWVJOHXJWRFL-GJZLLSJMSA-N |
| XLogP | 1.33 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|