C24H28N6O2 — CID 139460014
7-[(3S)-4-(2-aminoethyl)-3-methylpiperazin-1-yl]-3-(6,8-dimethylimidazo[1,2-a]pyrazin-2-yl)chromen-2-one (PubChem CID 139460014) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 7-[(3S)-4-(2-aminoethyl)-3-methylpiperazin-1-yl]-3-(6,8-dimethylimidazo[1,2-a]pyrazin-2-yl)chromen-2-one.
| Compound Name | 7-[(3S)-4-(2-aminoethyl)-3-methylpiperazin-1-yl]-3-(6,8-dimethylimidazo[1,2-a]pyrazin-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 139460014 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 7-[(3S)-4-(2-aminoethyl)-3-methylpiperazin-1-yl]-3-(6,8-dimethylimidazo[1,2-a]pyrazin-2-yl)chromen-2-one |
| SMILES | Cc1cn2cc(-c3cc4ccc(N5CCN(CCN)[C@@H](C)C5)cc4oc3=O)nc2c(C)n1 |
| InChI | InChI=1S/C24H28N6O2/c1-15-12-30-14-21(27-23(30)17(3)26-15)20-10-18-4-5-19(11-22(18)32-24(20)31)29-9-8-28(7-6-25)16(2)13-29/h4-5,10-12,14,16H,6-9,13,25H2,1-3H3/t16-/m0/s1 |
| InChIKey | AYXLMVBPMLTDFN-INIZCTEOSA-N |
| XLogP | 2.59 |
| TPSA | 92.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|