About N-hydroxy-4-[(1'-methyl-3-oxospiro[isoindole-1,4'-piperidine]-2-yl)methyl]benzamide
N-hydroxy-4-[(1'-methyl-3-oxospiro[isoindole-1,4'-piperidine]-2-yl)methyl]benzamide (PubChem CID 139460087) has the molecular formula C21H23N3O3
and a molecular weight of 365.43 g/mol. Its IUPAC name is N-hydroxy-4-[(1'-methyl-3-oxospiro[isoindole-1,4'-piperidine]-2-yl)methyl]benzamide.
Molecular Properties
| Compound Name | N-hydroxy-4-[(1'-methyl-3-oxospiro[isoindole-1,4'-piperidine]-2-yl)methyl]benzamide |
| PubChem CID | 139460087 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-hydroxy-4-[(1'-methyl-3-oxospiro[isoindole-1,4'-piperidine]-2-yl)methyl]benzamide |
| SMILES | CN1CCC2(CC1)c1ccccc1C(=O)N2Cc1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C21H23N3O3/c1-23-12-10-21(11-13-23)18-5-3-2-4-17(18)20(26)24(21)14-15-6-8-16(9-7-15)19(25)22-27/h2-9,27H,10-14H2,1H3,(H,22,25) |
| InChIKey | TVUKBGSULYGHSK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-4-[(1'-methyl-3-oxospiro[isoindole-1,4'-piperidine]-2-yl)methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-4-[(1'-methyl-3-oxospiro[isoindole-1,4'-piperidine]-2-yl)methyl]benzamide?
The IUPAC name of N-hydroxy-4-[(1'-methyl-3-oxospiro[isoindole-1,4'-piperidine]-2-yl)methyl]benzamide (CID 139460087) is N-hydroxy-4-[(1'-methyl-3-oxospiro[isoindole-1,4'-piperidine]-2-yl)methyl]benzamide.
What is the SMILES notation for N-hydroxy-4-[(1'-methyl-3-oxospiro[isoindole-1,4'-piperidine]-2-yl)methyl]benzamide?
The canonical SMILES for N-hydroxy-4-[(1'-methyl-3-oxospiro[isoindole-1,4'-piperidine]-2-yl)methyl]benzamide is CN1CCC2(CC1)c1ccccc1C(=O)N2Cc1ccc(C(=O)NO)cc1.
What is the InChIKey of N-hydroxy-4-[(1'-methyl-3-oxospiro[isoindole-1,4'-piperidine]-2-yl)methyl]benzamide?
The InChIKey is TVUKBGSULYGHSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O3/c1-23-12-10-21(11-13-23)18-5-3-2-4-17(18)20(26)24(21)14-15-6-8-16(9-7-15)19(25)22-27/h2-9,27H,10-14H2,1H3,(H,22,25).
What are the key properties of N-hydroxy-4-[(1'-methyl-3-oxospiro[isoindole-1,4'-piperidine]-2-yl)methyl]benzamide?
N-hydroxy-4-[(1'-methyl-3-oxospiro[isoindole-1,4'-piperidine]-2-yl)methyl]benzamide has a molecular weight of 365.43 g/mol, XLogP of 2.38, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-4-[(1'-methyl-3-oxospiro[isoindole-1,4'-piperidine]-2-yl)methyl]benzamide is sourced from PubChem (CID 139460087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).