About 2-tert-butyl-4-(3,3-dimethylbutyl)-1H-pyrrole
2-tert-butyl-4-(3,3-dimethylbutyl)-1H-pyrrole (PubChem CID 139460131) has the molecular formula C14H25N
and a molecular weight of 207.36 g/mol. Its IUPAC name is 2-tert-butyl-4-(3,3-dimethylbutyl)-1H-pyrrole.
Molecular Properties
| Compound Name | 2-tert-butyl-4-(3,3-dimethylbutyl)-1H-pyrrole |
| PubChem CID | 139460131 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 2-tert-butyl-4-(3,3-dimethylbutyl)-1H-pyrrole |
| SMILES | CC(C)(C)CCc1c[nH]c(C(C)(C)C)c1 |
| InChI | InChI=1S/C14H25N/c1-13(2,3)8-7-11-9-12(15-10-11)14(4,5)6/h9-10,15H,7-8H2,1-6H3 |
| InChIKey | MDRNKFBIPPSJOC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-tert-butyl-4-(3,3-dimethylbutyl)-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4-(3,3-dimethylbutyl)-1H-pyrrole?
The IUPAC name of 2-tert-butyl-4-(3,3-dimethylbutyl)-1H-pyrrole (CID 139460131) is 2-tert-butyl-4-(3,3-dimethylbutyl)-1H-pyrrole.
What is the SMILES notation for 2-tert-butyl-4-(3,3-dimethylbutyl)-1H-pyrrole?
The canonical SMILES for 2-tert-butyl-4-(3,3-dimethylbutyl)-1H-pyrrole is CC(C)(C)CCc1c[nH]c(C(C)(C)C)c1.
What is the InChIKey of 2-tert-butyl-4-(3,3-dimethylbutyl)-1H-pyrrole?
The InChIKey is MDRNKFBIPPSJOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N/c1-13(2,3)8-7-11-9-12(15-10-11)14(4,5)6/h9-10,15H,7-8H2,1-6H3.
What are the key properties of 2-tert-butyl-4-(3,3-dimethylbutyl)-1H-pyrrole?
2-tert-butyl-4-(3,3-dimethylbutyl)-1H-pyrrole has a molecular weight of 207.36 g/mol, XLogP of 4.29, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4-(3,3-dimethylbutyl)-1H-pyrrole is sourced from PubChem (CID 139460131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).