About 5-tert-butyl-2-[2-(1,3-dihydrotriazol-2-yl)propan-2-yl]tetrazole
5-tert-butyl-2-[2-(1,3-dihydrotriazol-2-yl)propan-2-yl]tetrazole (PubChem CID 139460586) has the molecular formula C10H19N7
and a molecular weight of 237.31 g/mol. Its IUPAC name is 5-tert-butyl-2-[2-(1,3-dihydrotriazol-2-yl)propan-2-yl]tetrazole.
Molecular Properties
| Compound Name | 5-tert-butyl-2-[2-(1,3-dihydrotriazol-2-yl)propan-2-yl]tetrazole |
| PubChem CID | 139460586 |
| Molecular Formula | C10H19N7 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 5-tert-butyl-2-[2-(1,3-dihydrotriazol-2-yl)propan-2-yl]tetrazole |
| SMILES | CC(C)(C)c1nnn(C(C)(C)N2NC=CN2)n1 |
| InChI | InChI=1S/C10H19N7/c1-9(2,3)8-13-15-17(14-8)10(4,5)16-11-6-7-12-16/h6-7,11-12H,1-5H3 |
| InChIKey | XCBSQEQGSOJIFB-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-tert-butyl-2-[2-(1,3-dihydrotriazol-2-yl)propan-2-yl]tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-2-[2-(1,3-dihydrotriazol-2-yl)propan-2-yl]tetrazole?
The IUPAC name of 5-tert-butyl-2-[2-(1,3-dihydrotriazol-2-yl)propan-2-yl]tetrazole (CID 139460586) is 5-tert-butyl-2-[2-(1,3-dihydrotriazol-2-yl)propan-2-yl]tetrazole.
What is the SMILES notation for 5-tert-butyl-2-[2-(1,3-dihydrotriazol-2-yl)propan-2-yl]tetrazole?
The canonical SMILES for 5-tert-butyl-2-[2-(1,3-dihydrotriazol-2-yl)propan-2-yl]tetrazole is CC(C)(C)c1nnn(C(C)(C)N2NC=CN2)n1.
What is the InChIKey of 5-tert-butyl-2-[2-(1,3-dihydrotriazol-2-yl)propan-2-yl]tetrazole?
The InChIKey is XCBSQEQGSOJIFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N7/c1-9(2,3)8-13-15-17(14-8)10(4,5)16-11-6-7-12-16/h6-7,11-12H,1-5H3.
What are the key properties of 5-tert-butyl-2-[2-(1,3-dihydrotriazol-2-yl)propan-2-yl]tetrazole?
5-tert-butyl-2-[2-(1,3-dihydrotriazol-2-yl)propan-2-yl]tetrazole has a molecular weight of 237.31 g/mol, XLogP of 0.46, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-2-[2-(1,3-dihydrotriazol-2-yl)propan-2-yl]tetrazole is sourced from PubChem (CID 139460586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).