C18H22N6OS2 — CID 139460797
cis-[N'-(2-phenylacetyl)carbamimidoyl] (1S,3R)-3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]cyclopentane-1-carboximidothioate (PubChem CID 139460797) has the molecular formula C18H22N6OS2 and a molecular weight of 402.55 g/mol. Its IUPAC name is cis-[N'-(2-phenylacetyl)carbamimidoyl] (1S,3R)-3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]cyclopentane-1-carboximidothioate.
| Compound Name | cis-[N'-(2-phenylacetyl)carbamimidoyl] (1S,3R)-3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]cyclopentane-1-carboximidothioate |
|---|---|
| PubChem CID | 139460797 |
| Molecular Formula | C18H22N6OS2 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | cis-[N'-(2-phenylacetyl)carbamimidoyl] (1S,3R)-3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]cyclopentane-1-carboximidothioate |
| SMILES | [H]/N=C(/S/C(N)=N/C(=O)Cc1ccccc1)[C@H]1CC[C@@H](Cc2nnc(N)s2)C1 |
| InChI | InChI=1S/C18H22N6OS2/c19-16(13-7-6-12(8-13)10-15-23-24-18(21)26-15)27-17(20)22-14(25)9-11-4-2-1-3-5-11/h1-5,12-13,19H,6-10H2,(H2,21,24)(H2,20,22,25)/b19-16+/t12-,13+/m1/s1 |
| InChIKey | HAEAMUZWJRPNEM-MMTAYPJXSA-N |
| XLogP | 2.87 |
| TPSA | 131.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|