C11H8FNO3 — CID 139461199
8-fluoro-6,10b-dihydro-5H-[1,3]oxazolo[2,3-a]isoquinoline-2,3-dione (PubChem CID 139461199) has the molecular formula C11H8FNO3 and a molecular weight of 221.19 g/mol. Its IUPAC name is 8-fluoro-6,10b-dihydro-5H-[1,3]oxazolo[2,3-a]isoquinoline-2,3-dione.
| Compound Name | 8-fluoro-6,10b-dihydro-5H-[1,3]oxazolo[2,3-a]isoquinoline-2,3-dione |
|---|---|
| PubChem CID | 139461199 |
| Molecular Formula | C11H8FNO3 |
| Molecular Weight | 221.19 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 8-fluoro-6,10b-dihydro-5H-[1,3]oxazolo[2,3-a]isoquinoline-2,3-dione |
| SMILES | O=C1OC2c3ccc(F)cc3CCN2C1=O |
| InChI | InChI=1S/C11H8FNO3/c12-7-1-2-8-6(5-7)3-4-13-9(14)11(15)16-10(8)13/h1-2,5,10H,3-4H2 |
| InChIKey | QXERWJSLLYPLSS-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.19 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|