C13H11Cl2NO2 — CID 139461480
5-cyclopropyl-3-(2,6-dichlorophenyl)-4,5-dihydro-1,2-oxazole-4-carbaldehyde (PubChem CID 139461480) has the molecular formula C13H11Cl2NO2 and a molecular weight of 284.14 g/mol. Its IUPAC name is 5-cyclopropyl-3-(2,6-dichlorophenyl)-4,5-dihydro-1,2-oxazole-4-carbaldehyde.
| Compound Name | 5-cyclopropyl-3-(2,6-dichlorophenyl)-4,5-dihydro-1,2-oxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 139461480 |
| Molecular Formula | C13H11Cl2NO2 |
| Molecular Weight | 284.14 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 5-cyclopropyl-3-(2,6-dichlorophenyl)-4,5-dihydro-1,2-oxazole-4-carbaldehyde |
| SMILES | O=CC1C(c2c(Cl)cccc2Cl)=NOC1C1CC1 |
| InChI | InChI=1S/C13H11Cl2NO2/c14-9-2-1-3-10(15)11(9)12-8(6-17)13(18-16-12)7-4-5-7/h1-3,6-8,13H,4-5H2 |
| InChIKey | KWGARIGHPISOAR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.14 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|