C15H11ClFN5O7 — CID 139461497
methyl 2-[2-[[4-[4-(3-chloro-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]oxy]ethylamino]-2-oxoacetate (PubChem CID 139461497) has the molecular formula C15H11ClFN5O7 and a molecular weight of 427.73 g/mol. Its IUPAC name is methyl 2-[2-[[4-[4-(3-chloro-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]oxy]ethylamino]-2-oxoacetate.
| Compound Name | methyl 2-[2-[[4-[4-(3-chloro-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]oxy]ethylamino]-2-oxoacetate |
|---|---|
| PubChem CID | 139461497 |
| Molecular Formula | C15H11ClFN5O7 |
| Molecular Weight | 427.73 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | methyl 2-[2-[[4-[4-(3-chloro-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]oxy]ethylamino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)NCCOc1nonc1-c1noc(=O)n1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H11ClFN5O7/c1-26-14(24)12(23)18-4-5-27-13-10(19-29-21-13)11-20-28-15(25)22(11)7-2-3-9(17)8(16)6-7/h2-3,6H,4-5H2,1H3,(H,18,23) |
| InChIKey | BQTQTLOFFYNHLA-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 151.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.73 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|