C13H10ClFN6O5 — CID 139461504
2-[[4-[4-(3-chloro-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]oxy]ethylurea (PubChem CID 139461504) has the molecular formula C13H10ClFN6O5 and a molecular weight of 384.71 g/mol. Its IUPAC name is 2-[[4-[4-(3-chloro-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]oxy]ethylurea.
| Compound Name | 2-[[4-[4-(3-chloro-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]oxy]ethylurea |
|---|---|
| PubChem CID | 139461504 |
| Molecular Formula | C13H10ClFN6O5 |
| Molecular Weight | 384.71 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 2-[[4-[4-(3-chloro-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]oxy]ethylurea |
| SMILES | NC(=O)NCCOc1nonc1-c1noc(=O)n1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H10ClFN6O5/c14-7-5-6(1-2-8(7)15)21-10(19-25-13(21)23)9-11(20-26-18-9)24-4-3-17-12(16)22/h1-2,5H,3-4H2,(H3,16,17,22) |
| InChIKey | MPGDVZMRMQVMRV-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 151.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.71 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|