C13H11ClFN5O4 — CID 139461540
4-(3-chloro-4-fluorophenyl)-3-[4-[2-(methylamino)ethoxy]-1,2,5-oxadiazol-3-yl]-1,2,4-oxadiazol-5-one (PubChem CID 139461540) has the molecular formula C13H11ClFN5O4 and a molecular weight of 355.71 g/mol. Its IUPAC name is 4-(3-chloro-4-fluorophenyl)-3-[4-[2-(methylamino)ethoxy]-1,2,5-oxadiazol-3-yl]-1,2,4-oxadiazol-5-one.
| Compound Name | 4-(3-chloro-4-fluorophenyl)-3-[4-[2-(methylamino)ethoxy]-1,2,5-oxadiazol-3-yl]-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 139461540 |
| Molecular Formula | C13H11ClFN5O4 |
| Molecular Weight | 355.71 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 4-(3-chloro-4-fluorophenyl)-3-[4-[2-(methylamino)ethoxy]-1,2,5-oxadiazol-3-yl]-1,2,4-oxadiazol-5-one |
| SMILES | CNCCOc1nonc1-c1noc(=O)n1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H11ClFN5O4/c1-16-4-5-22-12-10(17-24-19-12)11-18-23-13(21)20(11)7-2-3-9(15)8(14)6-7/h2-3,6,16H,4-5H2,1H3 |
| InChIKey | IJELCJCZBWXRQI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.71 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|