C13H10ClFN4O4S — CID 139461569
4-(3-chloro-4-fluorophenyl)-3-[4-(2-methylsulfanylethoxy)-1,2,5-oxadiazol-3-yl]-1,2,4-oxadiazol-5-one (PubChem CID 139461569) has the molecular formula C13H10ClFN4O4S and a molecular weight of 372.77 g/mol. Its IUPAC name is 4-(3-chloro-4-fluorophenyl)-3-[4-(2-methylsulfanylethoxy)-1,2,5-oxadiazol-3-yl]-1,2,4-oxadiazol-5-one.
| Compound Name | 4-(3-chloro-4-fluorophenyl)-3-[4-(2-methylsulfanylethoxy)-1,2,5-oxadiazol-3-yl]-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 139461569 |
| Molecular Formula | C13H10ClFN4O4S |
| Molecular Weight | 372.77 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 4-(3-chloro-4-fluorophenyl)-3-[4-(2-methylsulfanylethoxy)-1,2,5-oxadiazol-3-yl]-1,2,4-oxadiazol-5-one |
| SMILES | CSCCOc1nonc1-c1noc(=O)n1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H10ClFN4O4S/c1-24-5-4-21-12-10(16-23-18-12)11-17-22-13(20)19(11)7-2-3-9(15)8(14)6-7/h2-3,6H,4-5H2,1H3 |
| InChIKey | PXHLKTGVJMIFCY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 96.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.77 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|