C16H13FIN5S — CID 139461707
4-[6-(6-fluoro-4-iodo-2-pyridinyl)-5-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]-1,3-thiazole (PubChem CID 139461707) has the molecular formula C16H13FIN5S and a molecular weight of 453.28 g/mol. Its IUPAC name is 4-[6-(6-fluoro-4-iodo-2-pyridinyl)-5-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]-1,3-thiazole.
| Compound Name | 4-[6-(6-fluoro-4-iodo-2-pyridinyl)-5-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 139461707 |
| Molecular Formula | C16H13FIN5S |
| Molecular Weight | 453.28 g/mol |
| Exact Mass | 452.99 |
| IUPAC Name | 4-[6-(6-fluoro-4-iodo-2-pyridinyl)-5-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]-1,3-thiazole |
| SMILES | CC1c2cnc(-c3cscn3)nc2CCN1c1cc(I)cc(F)n1 |
| InChI | InChI=1S/C16H13FIN5S/c1-9-11-6-19-16(13-7-24-8-20-13)21-12(11)2-3-23(9)15-5-10(18)4-14(17)22-15/h4-9H,2-3H2,1H3 |
| InChIKey | GQESHBWNTOVNAI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|