C18H20F3NO5S — CID 139461937
methyl 1-[[5-(trifluoromethylsulfonyloxy)spiro[1,3-dihydroindene-2,3'-azetidine]-1'-yl]methyl]cyclopropane-1-carboxylate (PubChem CID 139461937) has the molecular formula C18H20F3NO5S and a molecular weight of 419.42 g/mol. Its IUPAC name is methyl 1-[[5-(trifluoromethylsulfonyloxy)spiro[1,3-dihydroindene-2,3'-azetidine]-1'-yl]methyl]cyclopropane-1-carboxylate.
| Compound Name | methyl 1-[[5-(trifluoromethylsulfonyloxy)spiro[1,3-dihydroindene-2,3'-azetidine]-1'-yl]methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 139461937 |
| Molecular Formula | C18H20F3NO5S |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | methyl 1-[[5-(trifluoromethylsulfonyloxy)spiro[1,3-dihydroindene-2,3'-azetidine]-1'-yl]methyl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(CN2CC3(Cc4ccc(OS(=O)(=O)C(F)(F)F)cc4C3)C2)CC1 |
| InChI | InChI=1S/C18H20F3NO5S/c1-26-15(23)17(4-5-17)11-22-9-16(10-22)7-12-2-3-14(6-13(12)8-16)27-28(24,25)18(19,20)21/h2-3,6H,4-5,7-11H2,1H3 |
| InChIKey | RHLSHLNTSXPXKE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|