C20H23ClINO4 — CID 139462096
(7R)-2-chloro-10-iodo-3-(3-methoxypropoxy)-7-propan-2-yl-6,7-dihydropyrido[1,2-d][1,4]benzoxazepin-11-one (PubChem CID 139462096) has the molecular formula C20H23ClINO4 and a molecular weight of 503.76 g/mol. Its IUPAC name is (7R)-2-chloro-10-iodo-3-(3-methoxypropoxy)-7-propan-2-yl-6,7-dihydropyrido[1,2-d][1,4]benzoxazepin-11-one.
| Compound Name | (7R)-2-chloro-10-iodo-3-(3-methoxypropoxy)-7-propan-2-yl-6,7-dihydropyrido[1,2-d][1,4]benzoxazepin-11-one |
|---|---|
| PubChem CID | 139462096 |
| Molecular Formula | C20H23ClINO4 |
| Molecular Weight | 503.76 g/mol |
| Exact Mass | 503.04 |
| IUPAC Name | (7R)-2-chloro-10-iodo-3-(3-methoxypropoxy)-7-propan-2-yl-6,7-dihydropyrido[1,2-d][1,4]benzoxazepin-11-one |
| SMILES | COCCCOc1cc2c(cc1Cl)-c1cc(=O)c(I)cn1[C@H](C(C)C)CO2 |
| InChI | InChI=1S/C20H23ClINO4/c1-12(2)17-11-27-19-9-20(26-6-4-5-25-3)14(21)7-13(19)16-8-18(24)15(22)10-23(16)17/h7-10,12,17H,4-6,11H2,1-3H3/t17-/m0/s1 |
| InChIKey | DOCYOVOOOBEGKR-KRWDZBQOSA-N |
| XLogP | 4.78 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.76 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|