C22H25NO4 — CID 139462235
18-tert-butyl-15-(hydroxymethyl)-6-methylidene-4,8-dioxa-17-azatetracyclo[9.8.0.03,9.012,17]nonadeca-1,3(9),10,12,15-pentaen-14-one (PubChem CID 139462235) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is 18-tert-butyl-15-(hydroxymethyl)-6-methylidene-4,8-dioxa-17-azatetracyclo[9.8.0.03,9.012,17]nonadeca-1,3(9),10,12,15-pentaen-14-one.
| Compound Name | 18-tert-butyl-15-(hydroxymethyl)-6-methylidene-4,8-dioxa-17-azatetracyclo[9.8.0.03,9.012,17]nonadeca-1,3(9),10,12,15-pentaen-14-one |
|---|---|
| PubChem CID | 139462235 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 18-tert-butyl-15-(hydroxymethyl)-6-methylidene-4,8-dioxa-17-azatetracyclo[9.8.0.03,9.012,17]nonadeca-1,3(9),10,12,15-pentaen-14-one |
| SMILES | C=C1COc2cc3c(cc2OC1)-c1cc(=O)c(CO)cn1C(C(C)(C)C)C3 |
| InChI | InChI=1S/C22H25NO4/c1-13-11-26-19-5-14-6-21(22(2,3)4)23-9-15(10-24)18(25)8-17(23)16(14)7-20(19)27-12-13/h5,7-9,21,24H,1,6,10-12H2,2-4H3 |
| InChIKey | TXVKDKNVDHUWFQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|