6H-pyrido[1,2-h][1,7]naphthyridine-9-carboxylic acid

C13H10N2O2 — CID 139462302

IUPAC6H-pyrido[1,2-h][1,7]naphthyridine-9-carboxylic acid
SMILESO=C(O)C1=CN2CC=c3cccnc3=C2C=C1
InChIInChI=1S/C13H10N2O2/c16-13(17)10-3-4-11-12-9(2-1-6-14-12)5-7-15(11)8-10/h1-6,8H,7H2,(H,16,17)
InChIKeyITSKRVJLLDBOCM-UHFFFAOYSA-N
MW226.24 g/mol
LogP-0.18
Rot. Bonds1

About 6H-pyrido[1,2-h][1,7]naphthyridine-9-carboxylic acid

6H-pyrido[1,2-h][1,7]naphthyridine-9-carboxylic acid (PubChem CID 139462302) has the molecular formula C13H10N2O2 and a molecular weight of 226.24 g/mol. Its IUPAC name is 6H-pyrido[1,2-h][1,7]naphthyridine-9-carboxylic acid.

Molecular Properties

Compound Name6H-pyrido[1,2-h][1,7]naphthyridine-9-carboxylic acid
PubChem CID139462302
Molecular FormulaC13H10N2O2
Molecular Weight226.24 g/mol
Exact Mass226.07
IUPAC Name6H-pyrido[1,2-h][1,7]naphthyridine-9-carboxylic acid
SMILESO=C(O)C1=CN2CC=c3cccnc3=C2C=C1
InChIInChI=1S/C13H10N2O2/c16-13(17)10-3-4-11-12-9(2-1-6-14-12)5-7-15(11)8-10/h1-6,8H,7H2,(H,16,17)
InChIKeyITSKRVJLLDBOCM-UHFFFAOYSA-N
XLogP-0.18
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.24
LogP ≤ 5-0.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 6H-pyrido[1,2-h][1,7]naphthyridine-9-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6H-pyrido[1,2-h][1,7]naphthyridine-9-carboxylic acid?
The IUPAC name of 6H-pyrido[1,2-h][1,7]naphthyridine-9-carboxylic acid (CID 139462302) is 6H-pyrido[1,2-h][1,7]naphthyridine-9-carboxylic acid.
What is the SMILES notation for 6H-pyrido[1,2-h][1,7]naphthyridine-9-carboxylic acid?
The canonical SMILES for 6H-pyrido[1,2-h][1,7]naphthyridine-9-carboxylic acid is O=C(O)C1=CN2CC=c3cccnc3=C2C=C1.
What is the InChIKey of 6H-pyrido[1,2-h][1,7]naphthyridine-9-carboxylic acid?
The InChIKey is ITSKRVJLLDBOCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O2/c16-13(17)10-3-4-11-12-9(2-1-6-14-12)5-7-15(11)8-10/h1-6,8H,7H2,(H,16,17).
What are the key properties of 6H-pyrido[1,2-h][1,7]naphthyridine-9-carboxylic acid?
6H-pyrido[1,2-h][1,7]naphthyridine-9-carboxylic acid has a molecular weight of 226.24 g/mol, XLogP of -0.18, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-pyrido[1,2-h][1,7]naphthyridine-9-carboxylic acid is sourced from PubChem (CID 139462302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).