C35H39F3N4O5 — CID 139462541
N-cyclopentyl-3-[5-[7-methyl-9-oxo-5-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethoxy]xanthen-3-yl]oxy-2-pyridinyl]propanamide (PubChem CID 139462541) has the molecular formula C35H39F3N4O5 and a molecular weight of 652.71 g/mol. Its IUPAC name is N-cyclopentyl-3-[5-[7-methyl-9-oxo-5-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethoxy]xanthen-3-yl]oxy-2-pyridinyl]propanamide.
| Compound Name | N-cyclopentyl-3-[5-[7-methyl-9-oxo-5-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethoxy]xanthen-3-yl]oxy-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 139462541 |
| Molecular Formula | C35H39F3N4O5 |
| Molecular Weight | 652.71 g/mol |
| Exact Mass | 652.29 |
| IUPAC Name | N-cyclopentyl-3-[5-[7-methyl-9-oxo-5-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethoxy]xanthen-3-yl]oxy-2-pyridinyl]propanamide |
| SMILES | Cc1cc(OCCN2CCN(CC(F)(F)F)CC2)c2oc3cc(Oc4ccc(CCC(=O)NC5CCCC5)nc4)ccc3c(=O)c2c1 |
| InChI | InChI=1S/C35H39F3N4O5/c1-23-18-29-33(44)28-10-9-26(46-27-8-6-24(39-21-27)7-11-32(43)40-25-4-2-3-5-25)20-30(28)47-34(29)31(19-23)45-17-16-41-12-14-42(15-13-41)22-35(36,37)38/h6,8-10,18-21,25H,2-5,7,11-17,22H2,1H3,(H,40,43) |
| InChIKey | HNFWLNRGNLBPCZ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 97.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.71 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|