C23H21N5O2 — CID 139462747
2-[(3R)-3-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperidine-1-carbonyl]naphthalene-1-carbaldehyde (PubChem CID 139462747) has the molecular formula C23H21N5O2 and a molecular weight of 399.45 g/mol. Its IUPAC name is 2-[(3R)-3-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperidine-1-carbonyl]naphthalene-1-carbaldehyde.
| Compound Name | 2-[(3R)-3-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperidine-1-carbonyl]naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 139462747 |
| Molecular Formula | C23H21N5O2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 2-[(3R)-3-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperidine-1-carbonyl]naphthalene-1-carbaldehyde |
| SMILES | Cc1cc([C@@H]2CCCN(C(=O)c3ccc4ccccc4c3C=O)C2)n2ncnc2n1 |
| InChI | InChI=1S/C23H21N5O2/c1-15-11-21(28-23(26-15)24-14-25-28)17-6-4-10-27(12-17)22(30)19-9-8-16-5-2-3-7-18(16)20(19)13-29/h2-3,5,7-9,11,13-14,17H,4,6,10,12H2,1H3/t17-/m1/s1 |
| InChIKey | JRJLKHYKLQIYAU-QGZVFWFLSA-N |
| XLogP | 3.42 |
| TPSA | 80.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|