C21H23N5O6S2 — CID 139462972
(1S,2S)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-1-hydroxy-1-(1,3-thiazol-4-yl)propane-2-sulfonamide (PubChem CID 139462972) has the molecular formula C21H23N5O6S2 and a molecular weight of 505.58 g/mol. Its IUPAC name is (1S,2S)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-1-hydroxy-1-(1,3-thiazol-4-yl)propane-2-sulfonamide.
| Compound Name | (1S,2S)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-1-hydroxy-1-(1,3-thiazol-4-yl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 139462972 |
| Molecular Formula | C21H23N5O6S2 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | (1S,2S)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-1-hydroxy-1-(1,3-thiazol-4-yl)propane-2-sulfonamide |
| SMILES | COc1cccc(OC)c1-n1c(NS(=O)(=O)[C@@H](C)[C@@H](O)c2cscn2)nnc1-c1ccc(C)o1 |
| InChI | InChI=1S/C21H23N5O6S2/c1-12-8-9-17(32-12)20-23-24-21(26(20)18-15(30-3)6-5-7-16(18)31-4)25-34(28,29)13(2)19(27)14-10-33-11-22-14/h5-11,13,19,27H,1-4H3,(H,24,25)/t13-,19+/m0/s1 |
| InChIKey | JADLAVQIMVVVCN-ORAYPTAESA-N |
| XLogP | 3.17 |
| TPSA | 141.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |