C20H18FN5O2 — CID 139463229
1-[(2-fluoro-5-methylphenyl)methyl]-3-(8-oxa-4,5,10-triazatricyclo[7.4.0.02,6]trideca-1(9),2(6),3,10,12-pentaen-11-yl)imidazolidin-2-one (PubChem CID 139463229) has the molecular formula C20H18FN5O2 and a molecular weight of 379.40 g/mol. Its IUPAC name is 1-[(2-fluoro-5-methylphenyl)methyl]-3-(8-oxa-4,5,10-triazatricyclo[7.4.0.02,6]trideca-1(9),2(6),3,10,12-pentaen-11-yl)imidazolidin-2-one.
| Compound Name | 1-[(2-fluoro-5-methylphenyl)methyl]-3-(8-oxa-4,5,10-triazatricyclo[7.4.0.02,6]trideca-1(9),2(6),3,10,12-pentaen-11-yl)imidazolidin-2-one |
|---|---|
| PubChem CID | 139463229 |
| Molecular Formula | C20H18FN5O2 |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 1-[(2-fluoro-5-methylphenyl)methyl]-3-(8-oxa-4,5,10-triazatricyclo[7.4.0.02,6]trideca-1(9),2(6),3,10,12-pentaen-11-yl)imidazolidin-2-one |
| SMILES | Cc1ccc(F)c(CN2CCN(c3ccc4c(n3)OCc3[nH]ncc3-4)C2=O)c1 |
| InChI | InChI=1S/C20H18FN5O2/c1-12-2-4-16(21)13(8-12)10-25-6-7-26(20(25)27)18-5-3-14-15-9-22-24-17(15)11-28-19(14)23-18/h2-5,8-9H,6-7,10-11H2,1H3,(H,22,24) |
| InChIKey | CLRMKUGEAHIEEJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |