C27H34F2N6O3 — CID 139463411
(2S)-2-[(6,7-difluoroquinazolin-4-yl)amino]-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid (PubChem CID 139463411) has the molecular formula C27H34F2N6O3 and a molecular weight of 528.60 g/mol. Its IUPAC name is (2S)-2-[(6,7-difluoroquinazolin-4-yl)amino]-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid.
| Compound Name | (2S)-2-[(6,7-difluoroquinazolin-4-yl)amino]-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
|---|---|
| PubChem CID | 139463411 |
| Molecular Formula | C27H34F2N6O3 |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | (2S)-2-[(6,7-difluoroquinazolin-4-yl)amino]-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
| SMILES | COCCN(CCCCc1ccc2c(n1)NCCC2)CC[C@H](Nc1ncnc2cc(F)c(F)cc12)C(=O)O |
| InChI | InChI=1S/C27H34F2N6O3/c1-38-14-13-35(11-3-2-6-19-8-7-18-5-4-10-30-25(18)33-19)12-9-23(27(36)37)34-26-20-15-21(28)22(29)16-24(20)31-17-32-26/h7-8,15-17,23H,2-6,9-14H2,1H3,(H,30,33)(H,36,37)(H,31,32,34)/t23-/m0/s1 |
| InChIKey | VSRHLQBJZGNGLG-QHCPKHFHSA-N |
| XLogP | 3.89 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|